C20H22F3NO3 — CID 23458466
2-[(4-ethoxyphenyl)-[4-(trifluoromethyl)phenoxy]methyl]morpholine (PubChem CID 23458466) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)-[4-(trifluoromethyl)phenoxy]methyl]morpholine.
| Compound Name | 2-[(4-ethoxyphenyl)-[4-(trifluoromethyl)phenoxy]methyl]morpholine |
|---|---|
| PubChem CID | 23458466 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[(4-ethoxyphenyl)-[4-(trifluoromethyl)phenoxy]methyl]morpholine |
| SMILES | CCOc1ccc(C(Oc2ccc(C(F)(F)F)cc2)C2CNCCO2)cc1 |
| InChI | InChI=1S/C20H22F3NO3/c1-2-25-16-7-3-14(4-8-16)19(18-13-24-11-12-26-18)27-17-9-5-15(6-10-17)20(21,22)23/h3-10,18-19,24H,2,11-13H2,1H3 |
| InChIKey | ANUOERIZQRUKML-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |