C20H23Cl2NO2 — CID 23458335
2-[(3,4-dichlorophenyl)-phenoxymethyl]-4-propan-2-ylmorpholine (PubChem CID 23458335) has the molecular formula C20H23Cl2NO2 and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)-phenoxymethyl]-4-propan-2-ylmorpholine.
| Compound Name | 2-[(3,4-dichlorophenyl)-phenoxymethyl]-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 23458335 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)-phenoxymethyl]-4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCOC(C(Oc2ccccc2)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H23Cl2NO2/c1-14(2)23-10-11-24-19(13-23)20(25-16-6-4-3-5-7-16)15-8-9-17(21)18(22)12-15/h3-9,12,14,19-20H,10-11,13H2,1-2H3 |
| InChIKey | LJHKHVVASIQEBA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |