C16H24N6O2 — CID 168606075
ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]piperidine-4-carboxylate (PubChem CID 168606075) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168606075 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccccc2/N=C(\N)N=C(N)N)CC1 |
| InChI | InChI=1S/C16H24N6O2/c1-2-24-14(23)11-7-9-22(10-8-11)13-6-4-3-5-12(13)20-16(19)21-15(17)18/h3-6,11H,2,7-10H2,1H3,(H6,17,18,19,20,21) |
| InChIKey | DGVZVCKYXMUEAX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|