C18H19F4N2O2+ — CID 7211751
ethyl 1-[8-fluoro-2-(trifluoromethyl)quinolin-1-ium-4-yl]piperidine-4-carboxylate (PubChem CID 7211751) has the molecular formula C18H19F4N2O2+ and a molecular weight of 371.35 g/mol. Its IUPAC name is ethyl 1-[8-fluoro-2-(trifluoromethyl)quinolin-1-ium-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[8-fluoro-2-(trifluoromethyl)quinolin-1-ium-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7211751 |
| Molecular Formula | C18H19F4N2O2+ |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | ethyl 1-[8-fluoro-2-(trifluoromethyl)quinolin-1-ium-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cc(C(F)(F)F)[nH+]c3c(F)cccc23)CC1 |
| InChI | InChI=1S/C18H18F4N2O2/c1-2-26-17(25)11-6-8-24(9-7-11)14-10-15(18(20,21)22)23-16-12(14)4-3-5-13(16)19/h3-5,10-11H,2,6-9H2,1H3/p+1 |
| InChIKey | QTUUMLMKFQNLHY-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 43.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |