C19H19F3N2O7S2 — CID 142915921
[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl] trifluoromethanesulfonate (PubChem CID 142915921) has the molecular formula C19H19F3N2O7S2 and a molecular weight of 508.50 g/mol. Its IUPAC name is [3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl] trifluoromethanesulfonate.
| Compound Name | [3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142915921 |
| Molecular Formula | C19H19F3N2O7S2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | [3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl] trifluoromethanesulfonate |
| SMILES | C=C/C(=C\C=C/C)C1C=C(OS(=O)(=O)C(F)(F)F)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C19H19F3N2O7S2/c1-3-5-6-14(4-2)15-11-17(31-33(29,30)19(20,21)22)13-23(12-15)32(27,28)18-9-7-16(8-10-18)24(25)26/h3-11,15H,2,12-13H2,1H3/b5-3-,14-6+ |
| InChIKey | DITZWYAGNFOMQS-RGWZVXDZSA-N |
| XLogP | 3.65 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|