C20H20BrN3O4S — CID 102490239
(1R,5S)-7-(4-bromophenyl)-3-(4-nitrophenyl)sulfonyl-6-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 102490239) has the molecular formula C20H20BrN3O4S and a molecular weight of 478.37 g/mol. Its IUPAC name is (1R,5S)-7-(4-bromophenyl)-3-(4-nitrophenyl)sulfonyl-6-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | (1R,5S)-7-(4-bromophenyl)-3-(4-nitrophenyl)sulfonyl-6-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 102490239 |
| Molecular Formula | C20H20BrN3O4S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | (1R,5S)-7-(4-bromophenyl)-3-(4-nitrophenyl)sulfonyl-6-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | C=CCN1[C@@H]2CN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C[C@H]1C2c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrN3O4S/c1-2-11-23-18-12-22(13-19(23)20(18)14-3-5-15(21)6-4-14)29(27,28)17-9-7-16(8-10-17)24(25)26/h2-10,18-20H,1,11-13H2/t18-,19+,20? |
| InChIKey | YEBBVPYYXQCNGQ-YOFSQIOKSA-N |
| XLogP | 3.38 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|