C21H24BrN3O5S — CID 118063572
[(8R)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 118063572) has the molecular formula C21H24BrN3O5S and a molecular weight of 510.41 g/mol. Its IUPAC name is [(8R)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 118063572 |
| Molecular Formula | C21H24BrN3O5S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | [(8R)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCCN2C(CO)C(c3ccc(Br)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C21H24BrN3O5S/c22-16-9-7-15(8-10-16)21-18-13-23(11-3-4-12-24(18)19(21)14-26)31(29,30)20-6-2-1-5-17(20)25(27)28/h1-2,5-10,18-19,21,26H,3-4,11-14H2/t18-,19?,21?/m0/s1 |
| InChIKey | KRBMCQGOOQNZJF-JSOIOWGOSA-N |
| XLogP | 2.97 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|