C42H40BrN3O7S — CID 150160902
[(4S,8R,9R,10S)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-10-(trityloxymethyl)-1,6-diazabicyclo[6.2.0]decan-4-yl] acetate (PubChem CID 150160902) has the molecular formula C42H40BrN3O7S and a molecular weight of 810.77 g/mol. Its IUPAC name is [(4S,8R,9R,10S)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-10-(trityloxymethyl)-1,6-diazabicyclo[6.2.0]decan-4-yl] acetate.
| Compound Name | [(4S,8R,9R,10S)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-10-(trityloxymethyl)-1,6-diazabicyclo[6.2.0]decan-4-yl] acetate |
|---|---|
| PubChem CID | 150160902 |
| Molecular Formula | C42H40BrN3O7S |
| Molecular Weight | 810.77 g/mol |
| Exact Mass | 809.18 |
| IUPAC Name | [(4S,8R,9R,10S)-9-(4-bromophenyl)-6-(2-nitrophenyl)sulfonyl-10-(trityloxymethyl)-1,6-diazabicyclo[6.2.0]decan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN2[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H](c3ccc(Br)cc3)[C@@H]2CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C42H40BrN3O7S/c1-30(47)53-36-25-26-45-38(28-44(27-36)54(50,51)40-20-12-11-19-37(40)46(48)49)41(31-21-23-35(43)24-22-31)39(45)29-52-42(32-13-5-2-6-14-32,33-15-7-3-8-16-33)34-17-9-4-10-18-34/h2-24,36,38-39,41H,25-29H2,1H3/t36-,38-,39+,41+/m0/s1 |
| InChIKey | FHKHHYHSMAACHO-ZKVGTJDLSA-N |
| XLogP | 7.53 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.77 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|