C29H27BrN4O8S — CID 146449178
2-[[(3S,4R,8R,9S)-9-(4-bromophenyl)-3,4-dihydroxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione (PubChem CID 146449178) has the molecular formula C29H27BrN4O8S and a molecular weight of 671.53 g/mol. Its IUPAC name is 2-[[(3S,4R,8R,9S)-9-(4-bromophenyl)-3,4-dihydroxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3S,4R,8R,9S)-9-(4-bromophenyl)-3,4-dihydroxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146449178 |
| Molecular Formula | C29H27BrN4O8S |
| Molecular Weight | 671.53 g/mol |
| Exact Mass | 670.07 |
| IUPAC Name | 2-[[(3S,4R,8R,9S)-9-(4-bromophenyl)-3,4-dihydroxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1[C@H](c2ccc(Br)cc2)[C@@H]2CN(S(=O)(=O)c3ccccc3[N+](=O)[O-])C[C@@H](O)[C@@H](O)CN12 |
| InChI | InChI=1S/C29H27BrN4O8S/c30-18-11-9-17(10-12-18)27-22-13-31(43(41,42)26-8-4-3-7-21(26)34(39)40)15-24(35)25(36)16-32(22)23(27)14-33-28(37)19-5-1-2-6-20(19)29(33)38/h1-12,22-25,27,35-36H,13-16H2/t22-,23?,24+,25-,27+/m0/s1 |
| InChIKey | XQKDPFLJCXEOHD-QATMJQODSA-N |
| XLogP | 2.22 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|