C15H16F3NO5S — CID 170005964
benzyl (2R)-2-ethyl-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 170005964) has the molecular formula C15H16F3NO5S and a molecular weight of 379.36 g/mol. Its IUPAC name is benzyl (2R)-2-ethyl-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | benzyl (2R)-2-ethyl-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 170005964 |
| Molecular Formula | C15H16F3NO5S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | benzyl (2R)-2-ethyl-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC[C@@H]1C=C(OS(=O)(=O)C(F)(F)F)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H16F3NO5S/c1-2-12-8-13(24-25(21,22)15(16,17)18)9-19(12)14(20)23-10-11-6-4-3-5-7-11/h3-8,12H,2,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | FBCIXGVWXDSSMY-GFCCVEGCSA-N |
| XLogP | 3.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|