C14H15F3N2O5S — CID 178096761
benzyl (5R)-5-methyl-6-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 178096761) has the molecular formula C14H15F3N2O5S and a molecular weight of 380.34 g/mol. Its IUPAC name is benzyl (5R)-5-methyl-6-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | benzyl (5R)-5-methyl-6-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 178096761 |
| Molecular Formula | C14H15F3N2O5S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | benzyl (5R)-5-methyl-6-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | C[C@@H]1C(OS(=O)(=O)C(F)(F)F)=NCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H15F3N2O5S/c1-10-12(24-25(21,22)14(15,16)17)18-7-8-19(10)13(20)23-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/t10-/m1/s1 |
| InChIKey | SWXDTMIMIBRLBB-SNVBAGLBSA-N |
| XLogP | 2.29 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|