C24H22F4N2O6S — CID 58432871
benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-3-(trifluoromethylsulfonyloxy)-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate (PubChem CID 58432871) has the molecular formula C24H22F4N2O6S and a molecular weight of 542.51 g/mol. Its IUPAC name is benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-3-(trifluoromethylsulfonyloxy)-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate.
| Compound Name | benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-3-(trifluoromethylsulfonyloxy)-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate |
|---|---|
| PubChem CID | 58432871 |
| Molecular Formula | C24H22F4N2O6S |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-3-(trifluoromethylsulfonyloxy)-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate |
| SMILES | C[C@H]1C[C@@]2(C=C(OS(=O)(=O)C(F)(F)F)C(=O)N2c2cccc(F)c2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H22F4N2O6S/c1-16-13-23(10-11-29(16)22(32)35-15-17-6-3-2-4-7-17)14-20(36-37(33,34)24(26,27)28)21(31)30(23)19-9-5-8-18(25)12-19/h2-9,12,14,16H,10-11,13,15H2,1H3/t16-,23+/m0/s1 |
| InChIKey | QVZODZZWPAQLOM-QMHKHESXSA-N |
| XLogP | 4.48 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|