C22H24FNO3 — CID 58432875
benzyl (2S,4S)-4-[(3-fluorophenyl)methyl]-4-formyl-2-methylpiperidine-1-carboxylate (PubChem CID 58432875) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is benzyl (2S,4S)-4-[(3-fluorophenyl)methyl]-4-formyl-2-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S,4S)-4-[(3-fluorophenyl)methyl]-4-formyl-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58432875 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | benzyl (2S,4S)-4-[(3-fluorophenyl)methyl]-4-formyl-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@](C=O)(Cc2cccc(F)c2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24FNO3/c1-17-13-22(16-25,14-19-8-5-9-20(23)12-19)10-11-24(17)21(26)27-15-18-6-3-2-4-7-18/h2-9,12,16-17H,10-11,13-15H2,1H3/t17-,22-/m0/s1 |
| InChIKey | OJLZTQGYNDODCM-JTSKRJEESA-N |
| XLogP | 4.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|