C17H21F2NO2 — CID 155793169
benzyl (2R,3S)-3-(difluoromethyl)-2-methyl-3-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 155793169) has the molecular formula C17H21F2NO2 and a molecular weight of 309.36 g/mol. Its IUPAC name is benzyl (2R,3S)-3-(difluoromethyl)-2-methyl-3-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-3-(difluoromethyl)-2-methyl-3-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155793169 |
| Molecular Formula | C17H21F2NO2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | benzyl (2R,3S)-3-(difluoromethyl)-2-methyl-3-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@]1(C(F)F)CCN(C(=O)OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C17H21F2NO2/c1-3-9-17(15(18)19)10-11-20(13(17)2)16(21)22-12-14-7-5-4-6-8-14/h3-8,13,15H,1,9-12H2,2H3/t13-,17+/m1/s1 |
| InChIKey | IKSOTGQNMHPFNG-DYVFJYSZSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|