C18H24N2O7S — CID 86686857
benzyl (2S,4R)-4-formyl-4-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-methylpiperidine-1-carboxylate (PubChem CID 86686857) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is benzyl (2S,4R)-4-formyl-4-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S,4R)-4-formyl-4-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86686857 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | benzyl (2S,4R)-4-formyl-4-[(2-methoxy-2-oxoethyl)sulfonylamino]-2-methylpiperidine-1-carboxylate |
| SMILES | COC(=O)CS(=O)(=O)N[C@]1(C=O)CCN(C(=O)OCc2ccccc2)[C@@H](C)C1 |
| InChI | InChI=1S/C18H24N2O7S/c1-14-10-18(13-21,19-28(24,25)12-16(22)26-2)8-9-20(14)17(23)27-11-15-6-4-3-5-7-15/h3-7,13-14,19H,8-12H2,1-2H3/t14-,18+/m0/s1 |
| InChIKey | JZGHGOFGBPLSTH-KBXCAEBGSA-N |
| XLogP | 0.84 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|