C22H22FN3O4 — CID 118798310
benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 118798310) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 118798310 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | benzyl (5R,7S)-1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | C[C@H]1C[C@]2(CCN1C(=O)OCc1ccccc1)C(=O)NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C22H22FN3O4/c1-15-13-22(10-11-25(15)21(29)30-14-16-6-3-2-4-7-16)19(27)24-20(28)26(22)18-9-5-8-17(23)12-18/h2-9,12,15H,10-11,13-14H2,1H3,(H,24,27,28)/t15-,22+/m0/s1 |
| InChIKey | HFZOFCXKEJGKKV-OYHNWAKOSA-N |
| XLogP | 3.44 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|