C16H17FN2O4 — CID 71117238
1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,8-diazaspiro[4.5]decane-8-carboxylic acid (PubChem CID 71117238) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,8-diazaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,8-diazaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 71117238 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-(3-fluorophenyl)-7-methyl-2,4-dioxo-1,8-diazaspiro[4.5]decane-8-carboxylic acid |
| SMILES | CC1CC2(CCN1C(=O)O)C(=O)CC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C16H17FN2O4/c1-10-9-16(5-6-18(10)15(22)23)13(20)8-14(21)19(16)12-4-2-3-11(17)7-12/h2-4,7,10H,5-6,8-9H2,1H3,(H,22,23) |
| InChIKey | WLRZYNRBLTWECA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|