C22H26FN3O4S — CID 66930734
(5R,7S)-4-benzyl-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid (PubChem CID 66930734) has the molecular formula C22H26FN3O4S and a molecular weight of 447.53 g/mol. Its IUPAC name is (5R,7S)-4-benzyl-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | (5R,7S)-4-benzyl-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 66930734 |
| Molecular Formula | C22H26FN3O4S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (5R,7S)-4-benzyl-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid |
| SMILES | C[C@H]1C[C@]2(CCN1C(=O)O)C(Cc1ccccc1)N(C)S(=O)(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FN3O4S/c1-16-15-22(11-12-25(16)21(27)28)20(13-17-7-4-3-5-8-17)24(2)31(29,30)26(22)19-10-6-9-18(23)14-19/h3-10,14,16,20H,11-13,15H2,1-2H3,(H,27,28)/t16-,20?,22+/m0/s1 |
| InChIKey | CCRFSXIPDGVMEX-XAYSJMGHSA-N |
| XLogP | 3.33 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |