C15H22F3NO7S — CID 175030250
3-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]propanoic acid (PubChem CID 175030250) has the molecular formula C15H22F3NO7S and a molecular weight of 417.40 g/mol. Its IUPAC name is 3-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]propanoic acid.
| Compound Name | 3-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]propanoic acid |
|---|---|
| PubChem CID | 175030250 |
| Molecular Formula | C15H22F3NO7S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 3-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C=C(OS(=O)(=O)C(F)(F)F)CCC1CCC(=O)O |
| InChI | InChI=1S/C15H22F3NO7S/c1-14(2,3)25-13(22)19-11-8-10(26-27(23,24)15(16,17)18)6-4-9(11)5-7-12(20)21/h8-9,11H,4-7H2,1-3H3,(H,19,22)(H,20,21)/t9?,11-/m1/s1 |
| InChIKey | FZIWBTCWCMMNGG-HCCKASOXSA-N |
| XLogP | 2.90 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|