C22H30F3NO7SSi — CID 162408646
4-[[3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carbonyl]oxymethyl]benzoic acid (PubChem CID 162408646) has the molecular formula C22H30F3NO7SSi and a molecular weight of 537.63 g/mol. Its IUPAC name is 4-[[3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carbonyl]oxymethyl]benzoic acid.
| Compound Name | 4-[[3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carbonyl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 162408646 |
| Molecular Formula | C22H30F3NO7SSi |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 4-[[3-methyl-3-triethylsilyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carbonyl]oxymethyl]benzoic acid |
| SMILES | CC[Si](CC)(CC)C1(C)CN(C(=O)OCc2ccc(C(=O)O)cc2)CC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H30F3NO7SSi/c1-5-35(6-2,7-3)21(4)15-26(13-12-18(21)33-34(30,31)22(23,24)25)20(29)32-14-16-8-10-17(11-9-16)19(27)28/h8-12H,5-7,13-15H2,1-4H3,(H,27,28) |
| InChIKey | OQSYKWRUAJYIMQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|