C16H18F3NO7S — CID 86620197
1-O-benzyl 3-O-methyl 4-(trifluoromethylsulfonyloxy)piperidine-1,3-dicarboxylate (PubChem CID 86620197) has the molecular formula C16H18F3NO7S and a molecular weight of 425.38 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl 4-(trifluoromethylsulfonyloxy)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl 4-(trifluoromethylsulfonyloxy)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 86620197 |
| Molecular Formula | C16H18F3NO7S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-O-benzyl 3-O-methyl 4-(trifluoromethylsulfonyloxy)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CN(C(=O)OCc2ccccc2)CCC1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO7S/c1-25-14(21)12-9-20(15(22)26-10-11-5-3-2-4-6-11)8-7-13(12)27-28(23,24)16(17,18)19/h2-6,12-13H,7-10H2,1H3 |
| InChIKey | UWICWYNIZWCPRD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|