C11H9F3O4S2 — CID 155731643
(4-ethyl-1-oxo-3H-2-benzothiophen-5-yl) trifluoromethanesulfonate (PubChem CID 155731643) has the molecular formula C11H9F3O4S2 and a molecular weight of 326.32 g/mol. Its IUPAC name is (4-ethyl-1-oxo-3H-2-benzothiophen-5-yl) trifluoromethanesulfonate.
| Compound Name | (4-ethyl-1-oxo-3H-2-benzothiophen-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155731643 |
| Molecular Formula | C11H9F3O4S2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | (4-ethyl-1-oxo-3H-2-benzothiophen-5-yl) trifluoromethanesulfonate |
| SMILES | CCc1c(OS(=O)(=O)C(F)(F)F)ccc2c1CSC2=O |
| InChI | InChI=1S/C11H9F3O4S2/c1-2-6-8-5-19-10(15)7(8)3-4-9(6)18-20(16,17)11(12,13)14/h3-4H,2,5H2,1H3 |
| InChIKey | QPYSTMZKEIZIDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|