C18H24FN3O5 — CID 170749381
tert-butyl 4-[(2-fluoro-4-nitrophenyl)-methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 170749381) has the molecular formula C18H24FN3O5 and a molecular weight of 381.40 g/mol. Its IUPAC name is tert-butyl 4-[(2-fluoro-4-nitrophenyl)-methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-fluoro-4-nitrophenyl)-methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170749381 |
| Molecular Formula | C18H24FN3O5 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | tert-butyl 4-[(2-fluoro-4-nitrophenyl)-methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CN(C(=O)C1CCN(C(=O)OC(C)(C)C)CC1)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C18H24FN3O5/c1-18(2,3)27-17(24)21-9-7-12(8-10-21)16(23)20(4)15-6-5-13(22(25)26)11-14(15)19/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | RUEVNNBEORQAKV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|