C33H43N7O5 — CID 166095370
methyl 5-[9-[[1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]piperidin-4-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]pyridine-2-carboxylate (PubChem CID 166095370) has the molecular formula C33H43N7O5 and a molecular weight of 617.75 g/mol. Its IUPAC name is methyl 5-[9-[[1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]piperidin-4-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[9-[[1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]piperidin-4-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166095370 |
| Molecular Formula | C33H43N7O5 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | methyl 5-[9-[[1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]piperidin-4-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC3(CCN(CC4CCN(c5cc(OC)c([N+](=O)[O-])cc5-c5cnn(C)c5)CC4)CC3)CC2)cn1 |
| InChI | InChI=1S/C33H43N7O5/c1-36-23-25(20-35-36)27-18-30(40(42)43)31(44-2)19-29(27)39-12-6-24(7-13-39)22-37-14-8-33(9-15-37)10-16-38(17-11-33)26-4-5-28(34-21-26)32(41)45-3/h4-5,18-21,23-24H,6-17,22H2,1-3H3 |
| InChIKey | XZRVHODGIMDMEO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 119.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|