C18H25N5O3 — CID 156744525
1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 156744525) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 156744525 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[5-methoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | COc1cc(N2CCC(N(C)C)CC2)c(-c2cnn(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N5O3/c1-20(2)14-5-7-22(8-6-14)16-10-18(26-4)17(23(24)25)9-15(16)13-11-19-21(3)12-13/h9-12,14H,5-8H2,1-4H3 |
| InChIKey | NSPFNQRZFYTNFL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|