C18H24N4O4 — CID 170774321
(2S,6R)-4-[5-ethoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-2,6-dimethylmorpholine (PubChem CID 170774321) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2S,6R)-4-[5-ethoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[5-ethoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 170774321 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2S,6R)-4-[5-ethoxy-2-(1-methylpyrazol-4-yl)-4-nitrophenyl]-2,6-dimethylmorpholine |
| SMILES | CCOc1cc(N2C[C@@H](C)O[C@@H](C)C2)c(-c2cnn(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N4O4/c1-5-25-18-7-16(21-9-12(2)26-13(3)10-21)15(6-17(18)22(23)24)14-8-19-20(4)11-14/h6-8,11-13H,5,9-10H2,1-4H3/t12-,13+ |
| InChIKey | YRGCTPPSXYTWNG-BETUJISGSA-N |
| XLogP | 3.01 |
| TPSA | 82.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|