C11H16N4O3 — CID 154966522
2-[(2S)-2,6-dimethylmorpholin-4-yl]-5-nitropyridin-4-amine (PubChem CID 154966522) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(2S)-2,6-dimethylmorpholin-4-yl]-5-nitropyridin-4-amine.
| Compound Name | 2-[(2S)-2,6-dimethylmorpholin-4-yl]-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 154966522 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[(2S)-2,6-dimethylmorpholin-4-yl]-5-nitropyridin-4-amine |
| SMILES | CC1CN(c2cc(N)c([N+](=O)[O-])cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H16N4O3/c1-7-5-14(6-8(2)18-7)11-3-9(12)10(4-13-11)15(16)17/h3-4,7-8H,5-6H2,1-2H3,(H2,12,13)/t7-,8?/m0/s1 |
| InChIKey | NJIRPJIWWBCFSF-JAMMHHFISA-N |
| XLogP | 1.19 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|