C12H19N3O — CID 104957780
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-methylpyridin-4-amine (PubChem CID 104957780) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-methylpyridin-4-amine.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-methylpyridin-4-amine |
|---|---|
| PubChem CID | 104957780 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-methylpyridin-4-amine |
| SMILES | Cc1cnc(N2C[C@@H](C)O[C@@H](C)C2)cc1N |
| InChI | InChI=1S/C12H19N3O/c1-8-5-14-12(4-11(8)13)15-6-9(2)16-10(3)7-15/h4-5,9-10H,6-7H2,1-3H3,(H2,13,14)/t9-,10+ |
| InChIKey | DJUMKFWPMDFJGW-AOOOYVTPSA-N |
| XLogP | 1.59 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |