About 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine
4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine (PubChem CID 171069212) has the molecular formula C14H19FN6O
and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine.
Molecular Properties
| Compound Name | 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine |
| PubChem CID | 171069212 |
| Molecular Formula | C14H19FN6O |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine |
| SMILES | C[C@H]1CN(c2cc(-n3ncc(F)c3N)c(N)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H19FN6O/c1-8-6-20(7-9(2)22-8)13-3-12(11(16)5-18-13)21-14(17)10(15)4-19-21/h3-5,8-9H,6-7,16-17H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | HKYUOTUHHSKOHJ-IUCAKERBSA-N |
| XLogP | 1.18 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine?
The IUPAC name of 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine (CID 171069212) is 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine.
What is the SMILES notation for 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine?
The canonical SMILES for 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine is C[C@H]1CN(c2cc(-n3ncc(F)c3N)c(N)cn2)C[C@H](C)O1.
What is the InChIKey of 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine?
The InChIKey is HKYUOTUHHSKOHJ-IUCAKERBSA-N. The full InChI is InChI=1S/C14H19FN6O/c1-8-6-20(7-9(2)22-8)13-3-12(11(16)5-18-13)21-14(17)10(15)4-19-21/h3-5,8-9H,6-7,16-17H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine?
4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine has a molecular weight of 306.35 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-4-fluoropyrazol-1-yl)-6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine is sourced from PubChem (CID 171069212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).