C16H17F3N4O3 — CID 133437985
[4-nitro-3-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]phenyl]methanol (PubChem CID 133437985) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is [4-nitro-3-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]phenyl]methanol.
| Compound Name | [4-nitro-3-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 133437985 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [4-nitro-3-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1N1CCC(c2ncc(C(F)(F)F)[nH]2)CC1 |
| InChI | InChI=1S/C16H17F3N4O3/c17-16(18,19)14-8-20-15(21-14)11-3-5-22(6-4-11)13-7-10(9-24)1-2-12(13)23(25)26/h1-2,7-8,11,24H,3-6,9H2,(H,20,21) |
| InChIKey | XVEKMQOOPQTDJJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|