C9H7ClN2S2 — CID 83266672
2-[(2-chloro-5-methyl-4-pyridinyl)sulfanyl]-1,3-thiazole (PubChem CID 83266672) has the molecular formula C9H7ClN2S2 and a molecular weight of 242.76 g/mol. Its IUPAC name is 2-[(2-chloro-5-methyl-4-pyridinyl)sulfanyl]-1,3-thiazole.
| Compound Name | 2-[(2-chloro-5-methyl-4-pyridinyl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 83266672 |
| Molecular Formula | C9H7ClN2S2 |
| Molecular Weight | 242.76 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 2-[(2-chloro-5-methyl-4-pyridinyl)sulfanyl]-1,3-thiazole |
| SMILES | Cc1cnc(Cl)cc1Sc1nccs1 |
| InChI | InChI=1S/C9H7ClN2S2/c1-6-5-12-8(10)4-7(6)14-9-11-2-3-13-9/h2-5H,1H3 |
| InChIKey | LLAPJQJBJXAULG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|