C10H5ClN2S2 — CID 55219157
3-chloro-4-(1,3-thiazol-2-ylsulfanyl)benzonitrile (PubChem CID 55219157) has the molecular formula C10H5ClN2S2 and a molecular weight of 252.75 g/mol. Its IUPAC name is 3-chloro-4-(1,3-thiazol-2-ylsulfanyl)benzonitrile.
| Compound Name | 3-chloro-4-(1,3-thiazol-2-ylsulfanyl)benzonitrile |
|---|---|
| PubChem CID | 55219157 |
| Molecular Formula | C10H5ClN2S2 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | 3-chloro-4-(1,3-thiazol-2-ylsulfanyl)benzonitrile |
| SMILES | N#Cc1ccc(Sc2nccs2)c(Cl)c1 |
| InChI | InChI=1S/C10H5ClN2S2/c11-8-5-7(6-12)1-2-9(8)15-10-13-3-4-14-10/h1-5H |
| InChIKey | JYINVICNHIPULN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|