C10H8ClFN4S — CID 80891170
4-[(3-chloro-2-pyridinyl)sulfanyl]-5-fluoro-N-methylpyrimidin-2-amine (PubChem CID 80891170) has the molecular formula C10H8ClFN4S and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-[(3-chloro-2-pyridinyl)sulfanyl]-5-fluoro-N-methylpyrimidin-2-amine.
| Compound Name | 4-[(3-chloro-2-pyridinyl)sulfanyl]-5-fluoro-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80891170 |
| Molecular Formula | C10H8ClFN4S |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 4-[(3-chloro-2-pyridinyl)sulfanyl]-5-fluoro-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(Sc2ncccc2Cl)n1 |
| InChI | InChI=1S/C10H8ClFN4S/c1-13-10-15-5-7(12)9(16-10)17-8-6(11)3-2-4-14-8/h2-5H,1H3,(H,13,15,16) |
| InChIKey | VNQVWYFSSHDSOE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |