C13H11FN4S — CID 80890508
5-fluoro-4-(1H-indol-2-ylsulfanyl)-N-methylpyrimidin-2-amine (PubChem CID 80890508) has the molecular formula C13H11FN4S and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-fluoro-4-(1H-indol-2-ylsulfanyl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(1H-indol-2-ylsulfanyl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80890508 |
| Molecular Formula | C13H11FN4S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-fluoro-4-(1H-indol-2-ylsulfanyl)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(Sc2cc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C13H11FN4S/c1-15-13-16-7-9(14)12(18-13)19-11-6-8-4-2-3-5-10(8)17-11/h2-7,17H,1H3,(H,15,16,18) |
| InChIKey | SJFCNDFXVWYCLY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |