C10H16ClN3S — CID 107765747
5-chloro-N-methyl-4-(2-methylbutylsulfanyl)pyrimidin-2-amine (PubChem CID 107765747) has the molecular formula C10H16ClN3S and a molecular weight of 245.78 g/mol. Its IUPAC name is 5-chloro-N-methyl-4-(2-methylbutylsulfanyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-methyl-4-(2-methylbutylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 107765747 |
| Molecular Formula | C10H16ClN3S |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-chloro-N-methyl-4-(2-methylbutylsulfanyl)pyrimidin-2-amine |
| SMILES | CCC(C)CSc1nc(NC)ncc1Cl |
| InChI | InChI=1S/C10H16ClN3S/c1-4-7(2)6-15-9-8(11)5-13-10(12-3)14-9/h5,7H,4,6H2,1-3H3,(H,12,13,14) |
| InChIKey | ZDSVVLWZCWYGOP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |