C9H15ClN4O — CID 83180608
3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 83180608) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 83180608 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CNc1ncc(Cl)c(NC(C)CCO)n1 |
| InChI | InChI=1S/C9H15ClN4O/c1-6(3-4-15)13-8-7(10)5-12-9(11-2)14-8/h5-6,15H,3-4H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | RSXRMPRBAUXKOX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |