C10H19ClN6 — CID 80904346
3-N-(5-chloro-2-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 80904346) has the molecular formula C10H19ClN6 and a molecular weight of 258.76 g/mol. Its IUPAC name is 3-N-(5-chloro-2-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(5-chloro-2-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 80904346 |
| Molecular Formula | C10H19ClN6 |
| Molecular Weight | 258.76 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-N-(5-chloro-2-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CC(CCN(C)C)Nc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C10H19ClN6/c1-7(4-5-17(2)3)14-9-8(11)6-13-10(15-9)16-12/h6-7H,4-5,12H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | PIHRVSWNKCXMLR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.76 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|