C8H7N5O2S2 — CID 114044807
N-methyl-5-nitro-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine (PubChem CID 114044807) has the molecular formula C8H7N5O2S2 and a molecular weight of 269.31 g/mol. Its IUPAC name is N-methyl-5-nitro-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | N-methyl-5-nitro-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114044807 |
| Molecular Formula | C8H7N5O2S2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | N-methyl-5-nitro-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine |
| SMILES | CNc1ncc([N+](=O)[O-])c(Sc2nccs2)n1 |
| InChI | InChI=1S/C8H7N5O2S2/c1-9-7-11-4-5(13(14)15)6(12-7)17-8-10-2-3-16-8/h2-4H,1H3,(H,9,11,12) |
| InChIKey | YWYHFUUQJNTJFP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|