C9H15N5O2S — CID 114045332
2-N,4-N-dimethyl-4-N-(2-methylsulfanylethyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 114045332) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-4-N-(2-methylsulfanylethyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-dimethyl-4-N-(2-methylsulfanylethyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114045332 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-N,4-N-dimethyl-4-N-(2-methylsulfanylethyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | CNc1ncc([N+](=O)[O-])c(N(C)CCSC)n1 |
| InChI | InChI=1S/C9H15N5O2S/c1-10-9-11-6-7(14(15)16)8(12-9)13(2)4-5-17-3/h6H,4-5H2,1-3H3,(H,10,11,12) |
| InChIKey | YINBTDSXPMPEJQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|