C9H12N4O4S — CID 114044801
ethyl 2-[2-(methylamino)-5-nitropyrimidin-4-yl]sulfanylacetate (PubChem CID 114044801) has the molecular formula C9H12N4O4S and a molecular weight of 272.29 g/mol. Its IUPAC name is ethyl 2-[2-(methylamino)-5-nitropyrimidin-4-yl]sulfanylacetate.
| Compound Name | ethyl 2-[2-(methylamino)-5-nitropyrimidin-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 114044801 |
| Molecular Formula | C9H12N4O4S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | ethyl 2-[2-(methylamino)-5-nitropyrimidin-4-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc(NC)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O4S/c1-3-17-7(14)5-18-8-6(13(15)16)4-11-9(10-2)12-8/h4H,3,5H2,1-2H3,(H,10,11,12) |
| InChIKey | VESMOWRTBVUBFR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|