C13H18N4S2 — CID 80990587
2-ethyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine (PubChem CID 80990587) has the molecular formula C13H18N4S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 2-ethyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | 2-ethyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80990587 |
| Molecular Formula | C13H18N4S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-ethyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
| SMILES | CCCNc1nc(CC)nc(Sc2nccs2)c1C |
| InChI | InChI=1S/C13H18N4S2/c1-4-6-14-11-9(3)12(17-10(5-2)16-11)19-13-15-7-8-18-13/h7-8H,4-6H2,1-3H3,(H,14,16,17) |
| InChIKey | CMEFARJDBJRRRK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|