C12H18N6S — CID 81007235
2-ethyl-6-hydrazinyl-5-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine (PubChem CID 81007235) has the molecular formula C12H18N6S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-ethyl-6-hydrazinyl-5-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-ethyl-6-hydrazinyl-5-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 81007235 |
| Molecular Formula | C12H18N6S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-ethyl-6-hydrazinyl-5-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine |
| SMILES | CCc1nc(NN)c(C)c(NCCc2nccs2)n1 |
| InChI | InChI=1S/C12H18N6S/c1-3-9-16-11(8(2)12(17-9)18-13)15-5-4-10-14-6-7-19-10/h6-7H,3-5,13H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | ARSOVRNVWLZCGH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|