C15H22N4S2 — CID 80989793
2-tert-butyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine (PubChem CID 80989793) has the molecular formula C15H22N4S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80989793 |
| Molecular Formula | C15H22N4S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-tert-butyl-5-methyl-N-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
| SMILES | CCCNc1nc(C(C)(C)C)nc(Sc2nccs2)c1C |
| InChI | InChI=1S/C15H22N4S2/c1-6-7-16-11-10(2)12(21-14-17-8-9-20-14)19-13(18-11)15(3,4)5/h8-9H,6-7H2,1-5H3,(H,16,18,19) |
| InChIKey | HZQLWRORASLRDI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|