C11H15F3N2O — CID 115515270
4-methoxy-2-N-(4,4,4-trifluorobutyl)benzene-1,2-diamine (PubChem CID 115515270) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 4-methoxy-2-N-(4,4,4-trifluorobutyl)benzene-1,2-diamine.
| Compound Name | 4-methoxy-2-N-(4,4,4-trifluorobutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115515270 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-methoxy-2-N-(4,4,4-trifluorobutyl)benzene-1,2-diamine |
| SMILES | COc1ccc(N)c(NCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2O/c1-17-8-3-4-9(15)10(7-8)16-6-2-5-11(12,13)14/h3-4,7,16H,2,5-6,15H2,1H3 |
| InChIKey | VPRDCYQJZUZZHS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|