C13H18F3N3O — CID 115515375
4-amino-N,N-dimethyl-3-(4,4,4-trifluorobutylamino)benzamide (PubChem CID 115515375) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-(4,4,4-trifluorobutylamino)benzamide.
| Compound Name | 4-amino-N,N-dimethyl-3-(4,4,4-trifluorobutylamino)benzamide |
|---|---|
| PubChem CID | 115515375 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-(4,4,4-trifluorobutylamino)benzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(NCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3O/c1-19(2)12(20)9-4-5-10(17)11(8-9)18-7-3-6-13(14,15)16/h4-5,8,18H,3,6-7,17H2,1-2H3 |
| InChIKey | POJATOXOQBJRMU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|