C12H18N4O3 — CID 83202470
2-[2-amino-5-(dimethylcarbamoyl)anilino]ethyl carbamate (PubChem CID 83202470) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[2-amino-5-(dimethylcarbamoyl)anilino]ethyl carbamate.
| Compound Name | 2-[2-amino-5-(dimethylcarbamoyl)anilino]ethyl carbamate |
|---|---|
| PubChem CID | 83202470 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[2-amino-5-(dimethylcarbamoyl)anilino]ethyl carbamate |
| SMILES | CN(C)C(=O)c1ccc(N)c(NCCOC(N)=O)c1 |
| InChI | InChI=1S/C12H18N4O3/c1-16(2)11(17)8-3-4-9(13)10(7-8)15-5-6-19-12(14)18/h3-4,7,15H,5-6,13H2,1-2H3,(H2,14,18) |
| InChIKey | BOXLXINRQUVDPT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|