C15H26N4O2 — CID 63358675
4-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-N,N-dimethylbenzamide (PubChem CID 63358675) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 63358675 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]-N,N-dimethylbenzamide |
| SMILES | COCCN(C)CCNc1cc(C(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C15H26N4O2/c1-18(2)15(20)12-5-6-13(16)14(11-12)17-7-8-19(3)9-10-21-4/h5-6,11,17H,7-10,16H2,1-4H3 |
| InChIKey | RGWKVKXHNFIFGZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|