C11H17N3O3 — CID 61295169
methyl 3-[(5-amino-6-ethoxy-2-pyridinyl)amino]propanoate (PubChem CID 61295169) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is methyl 3-[(5-amino-6-ethoxy-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 3-[(5-amino-6-ethoxy-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 61295169 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | methyl 3-[(5-amino-6-ethoxy-2-pyridinyl)amino]propanoate |
| SMILES | CCOc1nc(NCCC(=O)OC)ccc1N |
| InChI | InChI=1S/C11H17N3O3/c1-3-17-11-8(12)4-5-9(14-11)13-7-6-10(15)16-2/h4-5H,3,6-7,12H2,1-2H3,(H,13,14) |
| InChIKey | FSTXEEAQTCQCPD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |