C11H18N4O4S — CID 106341953
methyl 5-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate (PubChem CID 106341953) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is methyl 5-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate.
| Compound Name | methyl 5-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 106341953 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | methyl 5-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate |
| SMILES | CCNS(=O)(=O)CCNc1cc(C(=O)OC)c(N)cn1 |
| InChI | InChI=1S/C11H18N4O4S/c1-3-15-20(17,18)5-4-13-10-6-8(11(16)19-2)9(12)7-14-10/h6-7,15H,3-5,12H2,1-2H3,(H,13,14) |
| InChIKey | HKKGKHOIUVZIMP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |