C11H16ClN3O — CID 63833715
2-chloro-N-(2-cyclopentyloxyethyl)pyrimidin-4-amine (PubChem CID 63833715) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-chloro-N-(2-cyclopentyloxyethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2-cyclopentyloxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 63833715 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-chloro-N-(2-cyclopentyloxyethyl)pyrimidin-4-amine |
| SMILES | Clc1nccc(NCCOC2CCCC2)n1 |
| InChI | InChI=1S/C11H16ClN3O/c12-11-14-6-5-10(15-11)13-7-8-16-9-3-1-2-4-9/h5-6,9H,1-4,7-8H2,(H,13,14,15) |
| InChIKey | PNWUZRAPEPKGLF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|